| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Name | (+)-Dihydrocarvone |
|---|---|
| Synonyms | (2R,5R)-5-Isopropenyl-2-Methyl-Cyclohexan-1-One; (2R,5R)-5-Isopropenyl-2-Methyl-1-Cyclohexanone; (2R,5R)-2-Methyl-5-Prop-1-En-2-Yl-Cyclohexan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 |
| CAS Registry Number | 5948-04-9 |
| SMILES | [C@@H]1(CC([C@@H](CC1)C)=O)C(C)=C |
| InChI | 1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9-/m1/s1 |
| InChIKey | AZOCECCLWFDTAP-RKDXNWHRSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.5°C at 760 mmHg (Cal.) |
| Flash point | 82.577°C (Cal.) |
| (1) | E. L. Willighagen, H. M. G. W. Denissen, R. Wehrens, and L. M. C. Buydens. On the Use of 1H and 13C 1D NMR Spectra as QSPR Descriptors, J. Chem. Inf. Model., 46 (2), 487-494, 2006 |
|---|---|
| Market Analysis Reports |