| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Name | Dibenzo(b,h)pyrene |
|---|---|
| Synonyms | 4-05-00-02803 (Beilstein Handbook Reference); Brn 1881370; Benzo(R,S,T)Pentaphene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 189-55-9 |
| EINECS | 205-877-5 |
| SMILES | C1=C2C(=CC=C1)C=C6C3=C2C=CC4=C3C(=CC5=C4C=CC=C5)C=C6 |
| InChI | 1S/C24H14/c1-3-7-19-15(5-1)13-17-9-10-18-14-16-6-2-4-8-20(16)22-12-11-21(19)23(17)24(18)22/h1-14H |
| InChIKey | TUGYIJVAYAHHHM-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.265°C at 760 mmHg (Cal.) |
| Flash point | 281.957°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Alexandru T. Balaban and Milan Randić. Correlations between various ways of accounting for the distribution of π-electrons in benzenoids, New J. Chem., 2008, 32, 1071. |
|---|---|
| Market Analysis Reports |