| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Analytical chemistry >> Standard >> Volatile organic compounds (VOCs) |
|---|---|
| Name | Dibenzo(a,h)pyrene |
| Synonyms | 1,2,6,7-Dibenzopyrene; 3,4,8,9-Dibenzopyrene; 3,4,8,9-Dibenzpyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 189-64-0 |
| EINECS | 205-878-0 |
| SMILES | C1=C4C3=C2C(=C1)C6=C(C=C2C=CC3=C5C(=C4)C=CC=C5)C=CC=C6 |
| InChI | 1S/C24H14/c1-3-7-19-15(5-1)13-17-9-12-22-20-8-4-2-6-16(20)14-18-10-11-21(19)23(17)24(18)22/h1-14H |
| InChIKey | RXUSYFJGDZFVND-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Melting point | 308°C (Expl.) |
| Boiling point | 552.265°C at 760 mmHg (Cal.) |
| Flash point | 281.957°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Walter B. Wilson and Andres D. Campiglia. Determination of polycyclic aromatic hydrocarbons with molecular weight 302 in water samples by solid-phase nano-extraction and laser excited time-resolved shpol'skii spectroscopy, Analyst, 2011, 136, 3366. |
|---|---|
| Market Analysis Reports |