| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Lee Biosolutions, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (314) 968-1091 | |||
![]() |
info@leebio.com | |||
| Chemical manufacturer | ||||
| Name | Ovalene |
|---|---|
| Synonyms | Nsc 91578; Chebi:33091 |
| Molecular Structure | ![]() |
| Molecular Formula | C32H14 |
| Molecular Weight | 398.46 |
| CAS Registry Number | 190-26-1 |
| EINECS | 205-880-1 |
| SMILES | C1=C4C3=C2C(=C1)C=CC7=C2C6=C5C3=C(C=C4)C=C%10C5=C9C8=C6C(=C7)C=CC8=CC=C9C=C%10 |
| InChI | 1S/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H |
| InChIKey | LSQODMMMSXHVCN-UHFFFAOYSA-N |
| Density | 1.61g/cm3 (Cal.) |
|---|---|
| (1) | Jerry Ray Dias. The polyhex/polypent topological paradigm: regularities in the isomer numbers and topological properties of select subclasses of benzenoid hydrocarbons and related systems, Chem. Soc. Rev., 2010, 39, 1913. |
|---|---|
| Market Analysis Reports |