| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Phenanthro[1,10,9,8-opqra]Perylene |
|---|---|
| Synonyms | Phenanthro(1,10,9,8-Opqra)Perylene |
| Molecular Structure | ![]() |
| Molecular Formula | C28H14 |
| Molecular Weight | 350.42 |
| CAS Registry Number | 190-39-6 |
| SMILES | C1=CC=C5C7=C1C4=C3C8=C2C(=CC=CC2=CC3=CC=C4)C6=CC=CC(=C5)C6=C78 |
| InChI | 1S/C28H14/c1-5-15-13-16-6-3-11-21-22-12-4-8-18-14-17-7-2-10-20-19(9-1)23(15)27(25(16)21)28(24(17)20)26(18)22/h1-14H |
| InChIKey | RYQHWGXLBQHJST-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.839°C at 760 mmHg (Cal.) |
| Flash point | 315.186°C (Cal.) |
| (1) | Barbara V. Unterreiner, Marek Sierka and Reinhart Ahlrichs. Reaction pathways for growth of polycyclic aromatic hydrocarbons under combustion conditions, a DFT study, Phys. Chem. Chem. Phys., 2004, 6, 4377. |
|---|---|
| Market Analysis Reports |