| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | Phenanthro(3,4-b)thiophene |
|---|---|
| Synonyms | Naphtho[1,2-E]Benzothiophene; Zinc00991449; Phenanthro(3,4-B)Thiophene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10S |
| Molecular Weight | 234.32 |
| CAS Registry Number | 195-52-8 |
| SMILES | C1=CC4=C(C2=C1C=CC3=C2C=CC=C3)C=CS4 |
| InChI | 1S/C16H10S/c1-2-4-13-11(3-1)5-6-12-7-8-15-14(16(12)13)9-10-17-15/h1-10H |
| InChIKey | XRJUVKFVUBGLMG-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.716°C at 760 mmHg (Cal.) |
| Flash point | 166.058°C (Cal.) |
| (1) | Wolfgang Schrader, Saroj K. Panda, Klaus J. Brockmann and Thorsten Benter. Characterization of non-polar aromatic hydrocarbons in crude oil using atmospheric pressure laser ionization and Fourier transform ion cyclotron resonance mass spectrometry (APLI FT-ICR MS), Analyst, 2008, 133, 867. |
|---|---|
| Market Analysis Reports |