|
CAS#: 191-85-5 Product: 1,2-Benzoperylene No suppilers available for the product. |
| Name | 1,2-Benzoperylene |
|---|---|
| Synonyms | Benzo(A)Perylene; Benzo[B]Perylene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 191-85-5 |
| SMILES | C1=C5C4=C(C=C1)C3=C2C(=CC=CC2=CC=C3)C4=C6C(=C5)C=CC=C6 |
| InChI | 1S/C24H14/c1-2-10-18-16(6-1)14-17-9-5-12-20-19-11-3-7-15-8-4-13-21(22(15)19)24(18)23(17)20/h1-14H |
| InChIKey | JDPBLCQVGZLACA-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.265°C at 760 mmHg (Cal.) |
| Flash point | 281.957°C (Cal.) |
| (1) | Christopher A. Hunter, Kevin R. Lawson, Julie Perkins and Christopher J. Urch. Aromatic interactions, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 651. |
|---|---|
| Market Analysis Reports |