| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Benzo[a]pentacene |
|---|---|
| Synonyms | Isohexaphene; Benzo[A]Pentacene; Benzo(A)Pentacene |
| Molecular Structure | ![]() |
| Molecular Formula | C26H16 |
| Molecular Weight | 328.41 |
| CAS Registry Number | 239-98-5 |
| EINECS | 205-951-7 |
| SMILES | C1=C2C(=CC=C1)C=C3C(=C2)C=C4C(=C3)C=C5C(=C4)C=CC6=C5C=CC=C6 |
| InChI | 1S/C26H16/c1-2-7-19-12-22-15-24-16-26-20(10-9-17-5-3-4-8-25(17)26)13-23(24)14-21(22)11-18(19)6-1/h1-16H |
| InChIKey | PLKNNIMJRPBOSW-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.127°C at 760 mmHg (Cal.) |
| Flash point | 314.612°C (Cal.) |
| (1) | Kimihiro Hiruta, Sumio Tokita, Tatsuya Tachikawa, Fumio Noguchi and Kichisuke Nishimoto. Precise PPP molecular orbital calculations of excitation energies of polycyclic aromatic hydrocarbons. Part 6. Spectrochemical atomic softness parameter, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 975. |
|---|---|
| Market Analysis Reports |