| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,2,3,7,8,9-Hexachlorodibenzo-p-Dioxin |
|---|---|
| Synonyms | Hexachlorodibenzo-P-Dioxin; Mixture Of 1,2,3,6,7,8-Hxcdd And 1,2,3,7,8,9-Hxcdd; Hxcdd; 1,2,3,7,8,9-Hexachlorodibenzo-P-Dioxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H2Cl6O2 |
| Molecular Weight | 390.86 |
| CAS Registry Number | 19408-74-3 |
| SMILES | C1=C2C(=C(C(=C1Cl)Cl)Cl)OC3=C(O2)C=C(C(=C3Cl)Cl)Cl |
| InChI | 1S/C12H2Cl6O2/c13-3-1-5-11(9(17)7(3)15)20-12-6(19-5)2-4(14)8(16)10(12)18/h1-2H |
| InChIKey | LGIRBUBHIWTVCK-UHFFFAOYSA-N |
| Density | 1.778g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.012°C at 760 mmHg (Cal.) |
| Flash point | 182.889°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |