|
CAS#: 57117-44-9 Product: 1,2,3,6,7,8-Hexachlorodibenzofuran No suppilers available for the product. |
| Name | 1,2,3,6,7,8-Hexachlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,3,6,7,8-Hexachloro; 1,2,3,6,7,8-Hexa Polychlorinated Dibenzofuran; 1,2,3,6,7,8-Hexachlorodibenzofuran [Dioxin And Dioxin-Like Compounds] |
| Molecular Structure | ![]() |
| Molecular Formula | C12H2Cl6O |
| Molecular Weight | 374.87 |
| CAS Registry Number | 57117-44-9 |
| SMILES | C3=C2OC1=C(C(=C(C=C1C2=C(C(=C3Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl6O/c13-4-1-3-7-6(2-5(14)8(15)10(7)17)19-12(3)11(18)9(4)16/h1-2H |
| InChIKey | JEYJJJXOFWNEHN-UHFFFAOYSA-N |
| Density | 1.767g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.747°C at 760 mmHg (Cal.) |
| Flash point | 243.337°C (Cal.) |
| Market Analysis Reports |