| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| C D N Isotopes Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (800) 565-4696 / (514) 697-6254 | |||
![]() |
info@cdnisotopes.com, | |||
| Chemical manufacturer since 1993 | ||||
| Name | 2,3,4,5-Tetradeuteriothiophene |
|---|---|
| Synonyms | Thiophene-D4 |
| Molecular Structure | ![]() |
| Molecular Formula | C4D4S |
| Molecular Weight | 88.16 |
| CAS Registry Number | 2036-39-7 |
| SMILES | C1(=C(SC(=C1[2H])[2H])[2H])[2H] |
| InChI | 1S/C4H4S/c1-2-4-5-3-1/h1-4H/i1D,2D,3D,4D |
| InChIKey | YTPLMLYBLZKORZ-RHQRLBAQSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 84.16°C at 760 mmHg (Cal.) |
| Flash point | -1.111°C (Cal.) |
| (1) | F. Damay, J. RodrÃguez-Carvajal, D. André, F. Dunstetter and H. Szwarc. Orientational ordering in the low-temperature stable phases of deuterated thiophene, Acta Cryst. (2008). B64, 589-595 |
|---|---|
| Market Analysis Reports |