| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1H-Naphth[1,2-d]Imidazole |
|---|---|
| Synonyms | Nsc14306; Naphth[2,1-D]Imidazole; Naphtho[2,1-D]Imidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 |
| CAS Registry Number | 233-53-4 |
| SMILES | C1=CC2=C(C=C1)C3=C(C=C2)[NH]C=N3 |
| InChI | 1S/C11H8N2/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10/h1-7H,(H,12,13) |
| InChIKey | HCCNHYWZYYIOFM-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.05°C at 760 mmHg (Cal.) |
| Flash point | 275.449°C (Cal.) |
| (1) | Panduka B. Koswatta and Carl J. Lovely. Structure and synthesis of 2-aminoimidazole alkaloids from Leucetta and Clathrina sponges, Nat. Prod. Rep., 2011, 28, 511. |
|---|---|
| Market Analysis Reports |