| Shenzhen Nexconn Pharmatechs Ltd. | China | |||
|---|---|---|---|---|
![]() | www.nexconn.com | |||
![]() | +86 19068605196 | |||
![]() | jason.deng@nexconn.com | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic scandium, tantalum, thallium, tungsten, antimony, lanthanum, lead, vanadium, molybdenum, chromium, ytterbium, etc. |
|---|---|
| Name | Naphthenic acids vanadyl complexes |
| Synonyms | Vanadiumnaphthenateoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C44H28O8V |
| Molecular Weight | 735.63 |
| CAS Registry Number | 68553-60-6 |
| EC Number | 271-395-7 |
| SMILES | O=C(O[V](OC(=O)c1ccc2ccccc2c1)(OC(=O)c1ccc2ccccc2c1)OC(=O)c1ccc2ccccc2c1)c1ccc2ccccc2c1 |
| Dansity | 1.04 g/mL |
|---|---|
| Hazard Classification | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
|
Naphthenic acids vanadyl complexes are a group of chemical compounds consisting of vanadium in its +4 oxidation state coordinated to naphthenic acids. Naphthenic acids, which are a class of cycloaliphatic carboxylic acids typically found in crude oil, are complex molecules that are often considered impurities in petroleum refining. When these acids form complexes with vanadium, they create vanadyl complexes, which have garnered significant interest due to their unique properties and potential applications in various fields, including petroleum refining, catalysis, and environmental science. The discovery of naphthenic acids and their vanadyl complexes can be traced back to the study of petroleum and the chemical composition of crude oil. The presence of vanadium in crude oil was recognized early in the study of petroleum chemistry, as vanadium-containing compounds, particularly vanadyl porphyrins and vanadyl naphthenates, are frequently encountered. Vanadyl naphthenic complexes are formed when vanadium ions interact with the naphthenic acids present in crude oil during the refining process. These complexes are typically encountered in the residual fractions of petroleum, such as heavy oils and asphaltenes, where the vanadium is mostly present in the form of vanadyl (VO) complexes. The formation of naphthenic acid vanadyl complexes occurs through a coordination process in which vanadium ions, usually in the +4 oxidation state, bind to the oxygen atoms of naphthenic acids. The resulting complex is a vanadyl naphthenate, which typically consists of a vanadyl ion (VO^2+) coordinated to one or more naphthenic acid molecules. The structure of these complexes can vary depending on the number of naphthenic acid molecules involved, but they generally exhibit a coordination sphere around the vanadium center that imparts stability to the complex. The primary application of naphthenic acid vanadyl complexes is in the petroleum industry, particularly in the refining process. Vanadium is one of the most common metal impurities found in crude oil, and its presence in crude oil can lead to various operational challenges during refining. When crude oil is processed, vanadium, along with other metals such as nickel, is typically found in the form of vanadyl complexes, which can be problematic due to their catalytic activity and the formation of deposits on refining equipment, particularly in the form of high-temperature corrosion and fouling. As a result, vanadium removal from petroleum is an important process in refining, and understanding the chemistry of vanadyl naphthenates is essential for developing efficient methods for vanadium removal. Vanadyl naphthenic complexes have also been studied for their potential catalytic properties. Vanadium, as a transition metal, is capable of forming complexes that exhibit unique catalytic behaviors, particularly in oxidation reactions. Vanadyl naphthenic complexes have been investigated as potential catalysts in various chemical reactions, including the oxidation of hydrocarbons and the reduction of nitrogen oxides. These reactions are important in the context of environmental protection and industrial processes, where vanadium-containing catalysts could be used to reduce pollutants or facilitate chemical transformations. In addition to their role in catalysis, vanadyl naphthenic complexes are of interest in the field of environmental science. The presence of vanadium in crude oil and its subsequent release during petroleum processing can contribute to environmental pollution, particularly in the form of heavy metal contamination. The study of these complexes can help researchers understand the fate of vanadium in the environment and its potential impact on ecosystems. Efforts to develop more efficient methods for removing vanadium from petroleum products and minimizing its environmental impact have led to increased interest in the chemistry of vanadyl naphthenates. Moreover, naphthenic acid vanadyl complexes have been explored for their potential applications in the production of advanced materials. The ability of vanadium to form stable complexes with organic ligands, such as naphthenic acids, makes these complexes useful for the synthesis of new materials, including those used in energy storage and electronic devices. Research into the properties of vanadyl naphthenic complexes may provide insights into their potential use in the development of novel materials for use in batteries, supercapacitors, and other energy-related technologies. In summary, naphthenic acid vanadyl complexes are important compounds with applications primarily in the petroleum industry, catalysis, and environmental science. Their discovery and study have contributed to a better understanding of vanadium chemistry in crude oil refining and have led to the development of strategies to mitigate the challenges posed by vanadium contamination. Furthermore, the catalytic and material properties of vanadyl naphthenic complexes suggest their potential in a variety of industrial and environmental applications. References Jian Liu, Timothy A. Goetjen, Qining Wang, Julia G. Knapp, Megan C. Wasson, Ying Yang, Zoha H. Syed, Massimiliano Delferro, Justin M. Notestein, Omar K. Farha, Joseph T. Hupp, MOF-enabled confinement and related effects for chemical catalyst presentation and utilization, Chem. Soc. Rev., 2022, 51, 1045-1097. DOI: 10.1039/D1CS00968K Hai-Yu Li, Xiang-Jing Kong, Song-De Han, Jiandong Pang, Tao He, Guo-Ming Wang, Xian-He Bu, Metalation of metal-organic frameworks: fundamentals and applications, Chem. Soc. Rev., 2024, 53, 5626-5676. DOI: 10.1039/D3CS00873H Jeffrey D. Rudolf, Tyler A. Alsup, Baofu Xu, Zining Li, Bacterial terpenome, Nat. Prod. Rep., 2021, 38, 905-980 . DOI: 10.1039/D0NP00066C |
| Market Analysis Reports |