| Abosyn Chemicals Inc. | USA | |||
|---|---|---|---|---|
![]() | www.abosyn.com | |||
![]() | +1 (203) 683-8328 | |||
![]() | info@abosyn.com | |||
| Chemical manufacturer since 2014 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Piperidines |
|---|---|
| Name | 3-[2,3-Dihydro-4-(4-hydroxy-1-butyn-1-yl)-3-methyl-2-oxo-1H-benzimidazol-1-yl]-2,6-piperidinedione |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.33 |
| CAS Registry Number | 2360518-94-9 |
| SMILES | C1(C(CCC(N1)=O)N3C2=CC=CC(=C2N(C3=O)C)C#CCCO)=O |
|
3-[2,3-Dihydro-4-(4-hydroxy-1-butyn-1-yl)-3-methyl-2-oxo-1H-benzimidazol-1-yl]-2,6-piperidinedione is a complex organic compound that has garnered interest due to its structural features and potential applications in medicinal chemistry. The compound consists of a piperidinedione ring fused with a benzimidazole derivative, with additional functional groups, including a hydroxybutynyl group and a methyl group, which contribute to its reactivity and biological activity. The discovery of such compounds typically stems from efforts to design and synthesize bioactive molecules, particularly those that can interact with biological systems at the molecular level. The incorporation of benzimidazole and piperidine ring systems into a single molecular structure often aims to leverage the beneficial pharmacological properties of these two motifs, which are commonly found in a wide range of therapeutically relevant compounds. Benzimidazole derivatives, for instance, have been associated with anticancer, antiviral, and anti-inflammatory properties, while piperidine-based compounds are often explored for their potential to influence neurotransmitter systems, making them valuable in neuropharmacology and related fields. The piperidinedione portion of this molecule is recognized for its role in inhibiting certain enzymes and interacting with receptors in various biological pathways. The benzimidazole unit further enhances the molecule's capacity to bind with proteins or enzymes that play crucial roles in diseases such as cancer and neurodegenerative disorders. The additional hydroxybutynyl group may contribute to the compound’s overall bioactivity, potentially facilitating interactions with biological molecules through hydrogen bonding or other mechanisms. This compound's synthesis likely involves multi-step chemical reactions, including functionalization of the piperidine and benzimidazole rings and the addition of the hydroxybutynyl group. The synthesis of such a compound is part of a broader effort to develop new chemical entities with targeted biological activities, and the design is informed by the known pharmacological effects of its individual components. Analytical techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and high-performance liquid chromatography (HPLC) would be employed to confirm the purity and structure of the compound during its synthesis. In terms of applications, the compound is most likely explored for its potential medicinal properties. Compounds containing benzimidazole and piperidine rings have been studied for their roles in anticancer, antibacterial, and anti-inflammatory therapies. Given the structural similarities to other bioactive molecules, this compound may be of interest in drug discovery efforts aimed at developing new therapies for conditions such as cancer, neurodegenerative diseases, and possibly infectious diseases. The hydroxybutynyl group could enhance the compound’s solubility and bioavailability, critical factors for its potential development as a pharmaceutical agent. Moreover, this type of compound could serve as a lead structure in drug development, where modifications to the functional groups or core structure are made to optimize potency, selectivity, and pharmacokinetic properties. The presence of both a benzimidazole and piperidinedione structure in a single molecule may provide a dual mechanism of action, making it a potentially valuable candidate for combination therapies in treating complex diseases. Future research would likely focus on further characterizing its pharmacodynamics and pharmacokinetics, identifying the specific biological targets it interacts with, and assessing its efficacy in preclinical and clinical models. Bioassays, receptor binding studies, and molecular docking simulations would help elucidate the precise mechanisms by which the compound exerts its effects in biological systems. In conclusion, 3-[2,3-Dihydro-4-(4-hydroxy-1-butyn-1-yl)-3-methyl-2-oxo-1H-benzimidazol-1-yl]-2,6-piperidinedione represents a structurally interesting compound with potential therapeutic applications. Its synthesis and exploration are in line with ongoing efforts to discover new chemical entities that can address unmet medical needs, particularly in areas such as cancer, neurodegenerative diseases, and infectious diseases. Further research will continue to investigate its full range of biological activities and its potential for development as a novel drug candidate. References 2021. Compounds and methods for the targeted degradation of irak-4. WO-2022266258-A1 2021. Egfr degraders and associated methods of use. WO-2022228556-A1 2020. Irak degraders and uses thereof. WO-2022147465-A1 |
| Market Analysis Reports |