| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Alsachim SAS | France | |||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| LGC Standards | UK | |||
|---|---|---|---|---|
![]() |
+44 (20) 8943-8480 | |||
![]() |
uksales@lgcstandards.com | |||
| Chemical manufacturer since 2007 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Standard material |
|---|---|
| Name | Dihydrohydroxycodeinone |
| Synonyms | Roxicet; Supendol [Canada]; Oxycodone (Usan) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 |
| CAS Registry Number | 76-42-6 |
| EINECS | 200-960-2 |
| SMILES | [C@@]23(CCC(=O)[C@@H]4OC1=C5C(=CC=C1OC)C[C@H]2N(CC[C@@]345)C)O |
| InChI | 1S/C18H21NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,13,16,21H,5-9H2,1-2H3/t13-,16+,17+,18-/m1/s1 |
| InChIKey | BRUQQQPBMZOVGD-XFKAJCMBSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.6±50.0°C at 760 mmHg (Cal.) |
| Flash point | 257.1±30.1°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 9143 Details |
|---|---|
| CSA Schedule: II | |
| Is Narcotics? Yes | |
| SDS | Available |
| (1) | Gaik B. Kok and Peter J. Scammells. Improved synthesis of 14-hydroxy opioid pharmaceuticals and intermediates, RSC Advances, 2012, 2, 11318. |
|---|---|
| Market Analysis Reports |