Online Database of Chemicals from Around the World
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl 2-Methylpropanoate
[CAS 242812-05-1]
Identification
| Name |
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl 2-Methylpropanoate |
| Synonyms |
1H,1H,2H,2H-Perfluorooctyl isobutanoate 97%; 1H,1H,2H,2H-Perfluorooctyl isobutyrate; MFCD01862031 |
|
| Molecular Structure |
 |
| Molecular Formula |
C12H11F13O2 |
| Molecular Weight |
434.19 |
| CAS Registry Number |
242812-05-1 |
| SMILES |
FC(F)(CCOC(=O)C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI |
1S/C12H11F13O2/c1-5(2)6(26)27-4-3-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h5H,3-4H2,1-2H3 |
| InChIKey |
VEAHUEAEPJJBDN-UHFFFAOYSA-N |
|
Properties
| Density |
1.44g/cm3 (Cal.) |
| Boiling point |
92°C (Expl.) |
|
217.291°C at 760 mmHg (Cal.) |
| Flash point |
83.01°C (Cal.) |
| Refractive index |
1.426 (Expl.) |
|
1.329 (Cal.) |
|
Safety Data
| Safety Description |
R36/37/38 |
|
Irritant |
|
S23,S24/25,S36/37/39,S45 |
| SDS |
Available |
|
Related Products
1-(4,4,5,5,6,6,... 1-(4,4,5,5,6,6,... 1,1,1,2,2,3,3,4... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 2-[[(3,3,4,4,5,... 3-[(3,3,4,4,5,5... 4-(3,3,4,4,5,5,... 1,1,1,2,2,3,3,4... 4,4,5,5,6,6,7,7... 1,1,1,2,2,3,3,4... 1,1,1,2,2,3,3,4... 1,1,1,2,2,3,3,4... (7E)-1,1,1,2,2,... 1,1,2,3,3,4,4,5...