Online Database of Chemicals from Around the World
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid
[CAS 27619-97-2]
Identification| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C8H5F13O3S |
| Molecular Weight | 428.17 |
| CAS Registry Number | 27619-97-2 |
| EC Number | 248-580-6 |
| SMILES | C(CS(=O)(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|
Properties
| Solubility | 1.06 mg/L (25 °C water) |
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.330, Calc.* |
| Melting point | 62.63 °C |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS05;GHS07;GHS08;GHS09 Danger Details |
| Risk Statements | H302+H332-H314-H351-H360D-H362-H372-H411 Details |
| Safety Statements | P260-P263-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Serious eye damage | Eye Dam. | 1 | H318 |
| Skin corrosion | Skin Corr. | 1B | H314 |
| Acute toxicity | Acute Tox. | 4 | H302 |
| Specific target organ toxicity - repeated exposure | STOT RE | 2 | H373 |
| Skin corrosion | Skin Corr. | 1A | H314 |
| Skin corrosion | Skin Corr. | 1C | H314 |
|
| SDS | Available |
|
Related Products
6,6,7,7,8,8,9,9... Tridecafluoro-N... 1,1,1,2,2,3,3,4... 4,4,5,5,6,6,7,7... 4,4,5,5,6,6,7,7... 1-(4,4,5,5,6,6,... 1-(4,4,5,5,6,6,... 1,1,1,2,2,3,3,4... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 3,3,4,4,5,5,6,6... 2-[[(3,3,4,4,5,... 3-[(3,3,4,4,5,5... 4-(3,3,4,4,5,5,... 1,1,1,2,2,3,3,4... 4,4,5,5,6,6,7,7...