|
CAS#: 25215-62-7 Product: (Z)-2-Butenedioic Acid Monobutyl Ester, Polymer With Ethenylbenzene No suppilers available for the product. |
| Name | (Z)-2-Butenedioic Acid Monobutyl Ester, Polymer With Ethenylbenzene |
|---|---|
| Synonyms | (Z)-4-Butoxy-4-Oxo-But-2-Enoic Acid; Styrene; (Z)-4-Butoxy-4-Keto-But-2-Enoic Acid; Styrene; (Z)-4-Butoxy-4-Oxo-But-2-Enoic Acid; Ethenylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 25215-62-7 |
| SMILES | C(OC(=O)\C=C/C(=O)O)CCC.C1=C(C=CC=C1)C=C |
| InChI | 1S/C8H12O4.C8H8/c1-2-3-6-12-8(11)5-4-7(9)10;1-2-8-6-4-3-5-7-8/h4-5H,2-3,6H2,1H3,(H,9,10);2-7H,1H2/b5-4-; |
| InChIKey | AAFCVNRTKWSHAI-MKWAYWHRSA-N |
| Boiling point | 289.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 113.9°C (Cal.) |
| Market Analysis Reports |