| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | (2Z)-2-Butenedioic Acid Monoethyl Ester, Polymer With Ethene And Methyl 2-Propenoate |
|---|---|
| Synonyms | (Z)-4-Ethoxy-4-Oxo-But-2-Enoic Acid; Ethylene; 2-Methylprop-2-Enoate; (Z)-4-Ethoxy-4-Oxobut-2-Enoic Acid; Ethylene; 2-Methylprop-2-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17O6 |
| Molecular Weight | 257.26 |
| CAS Registry Number | 54545-50-5 |
| SMILES | C(OC(=O)\C=C/C(=O)O)C.CC(C([O-])=O)=C.C=C |
| InChI | 1S/C6H8O4.C4H6O2.C2H4/c1-2-10-6(9)4-3-5(7)8;1-3(2)4(5)6;1-2/h3-4H,2H2,1H3,(H,7,8);1H2,2H3,(H,5,6);1-2H2/p-1/b4-3-;; |
| InChIKey | IYIAKRPEENNMLD-GSBNXNDCSA-M |
| Boiling point | 261.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.6°C (Cal.) |
| Market Analysis Reports |