| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | alpha-D-Lyxofuranose |
|---|---|
| Synonyms | (2S,3S,4R,5R)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol; a-d-lyxofuranose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 25545-04-4 |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H](O1)O)O)O)O |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4+,5+/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-STGXQOJASA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 180.8±27.9°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| (1) | Stefan Taubert, Henrik Konschin and Dage Sundholm. Computational studies of C NMR chemical shifts of saccharides, Phys. Chem. Chem. Phys., 2005, 7, 2561. |
|---|---|
| Market Analysis Reports |