| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | L-Lyxofuranose |
|---|---|
| Synonyms | (3R,4S,5S)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 34436-17-4 |
| SMILES | O[C@@H]1[C@H](CO)OC(O)[C@@H]1O |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4+,5?/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-AEQNFAKKSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.36°C at 760 mmHg (Cal.) |
| Flash point | 180.812°C (Cal.) |
| (1) | Fan Ao, Jaenicke Stephan, Chuah Gaik-Khuan. A heterogeneous Pd–Bi/C catalyst in the synthesis of l-lyxose and l-ribose from naturally occurring d-sugars, Organic & Biomolecular Chemistry, 2011 |
|---|---|
| Market Analysis Reports |