|
CAS#: 25805-30-5 Product: 2,6-Dimethylphenol polymer with ethenylbenzene No suppilers available for the product. |
| Name | 2,6-Dimethylphenol polymer with ethenylbenzene |
|---|---|
| Synonyms | 2,6-Dimethylphenol; Ethenylbenzene; Phenol, 2,6-Dimethyl-, Polymer With Ethenylbenzene; Xyron |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 |
| CAS Registry Number | 25805-30-5 |
| SMILES | C1=C(C(=C(C=C1)C)O)C.C2=C(C=CC=C2)C=C |
| InChI | 1S/C8H10O.C8H8/c1-6-4-3-5-7(2)8(6)9;1-2-8-6-4-3-5-7-8/h3-5,9H,1-2H3;2-7H,1H2 |
| InChIKey | QTNKAUVVWGYBNU-UHFFFAOYSA-N |
| Boiling point | 201.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 78.3°C (Cal.) |
| Market Analysis Reports |