| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | N,N-Dimethyl-1-Phenothiazin-10-Ylpropan-2-Amine |
|---|---|
| Synonyms | N,N-Dimethyl-1-Phenothiazin-10-Yl-Propan-2-Amine; N,N-Dimethyl-1-(10-Phenothiazinyl)Propan-2-Amine; Dimethyl-(1-Methyl-2-Phenothiazin-10-Yl-Ethyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.42 |
| CAS Registry Number | 73745-50-3 |
| SMILES | C1=CC=CC2=C1N(C3=C(S2)C=CC=C3)CC(C)N(C)C |
| InChI | 1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.7±34.0°C at 760 mmHg (Cal.) |
| Flash point | 198.0±25.7°C (Cal.) |
| (1) | Manthena V. S. Varma, Khandavilli Sateesh, and Ramesh Panchagnula. Functional Role of P-Glycoprotein in Limiting Intestinal Absorption of Drugs: Contribution of Passive Permeability to P-Glycoprotein Mediated Efflux Transport, Mol. Pharmaceutics 2005, 2(1), 12-21. |
|---|---|
| Market Analysis Reports |