| Sichuan Taienkang Pharmaceutical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.taienkangpharma.com | |||
![]() | +86 15102825326 | |||
![]() | sales@taienkangpharma.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Nitrile compound |
|---|---|
| Name | (R)-3-(Amino(3-amino-4-fluorophenyl)methyl)benzonitrile hydrochloride |
| Synonyms | 3-[(R)-amino(3-amino-4-fluorophenyl)methyl]benzonitrile hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13ClFN3 |
| Molecular Weight | 277.72 |
| CAS Registry Number | 2602377-06-8 |
| SMILES | N#CC1=CC=CC([C@@H](N)C2=CC=C(F)C(N)=C2)=C1.[H]Cl |
|
(R)-3-(Amino(3-amino-4-fluorophenyl)methyl)benzonitrile hydrochloride is a chemical compound that has garnered attention for its unique structure and potential applications in medicinal chemistry. The compound consists of a benzonitrile core with a substituted amino group and a fluorophenyl unit, along with a hydrochloride salt form to enhance its solubility and stability. The (R)-configuration of the chiral center in the molecule suggests that it may exhibit specific interactions with biological targets, potentially making it useful in the development of novel therapeutic agents. The discovery of (R)-3-(Amino(3-amino-4-fluorophenyl)methyl)benzonitrile hydrochloride is rooted in efforts to design compounds that can selectively modulate biological systems, particularly those involving neurotransmission and receptor binding. The fluorophenyl group incorporated into the structure may offer additional lipophilicity, which could influence the compound's ability to cross cell membranes or interact with hydrophobic sites on enzymes or receptors. The amino group, along with the benzonitrile, suggests that the compound might have the ability to bind to a variety of receptors or enzymes involved in neurological, cardiovascular, or inflammatory processes. The synthesis of (R)-3-(Amino(3-amino-4-fluorophenyl)methyl)benzonitrile hydrochloride generally involves a multi-step process. First, the benzonitrile scaffold is synthesized and functionalized with the fluorophenyl and amino groups. The addition of the amino(3-amino-4-fluorophenyl)methyl group is a key step that requires careful stereochemical control to ensure the correct (R)-enantiomer is formed. The final product is isolated as the hydrochloride salt, which is more stable and water-soluble than its free base form, making it more suitable for biological testing and potential pharmaceutical development. The applications of (R)-3-(Amino(3-amino-4-fluorophenyl)methyl)benzonitrile hydrochloride are primarily centered around its potential as a pharmacological agent. The presence of the fluorine atom and the amino group in the aromatic ring suggests that it could interact with specific receptors or enzymes, potentially affecting signaling pathways associated with neurodegenerative diseases, psychiatric disorders, or cancer. Research into the compound's activity in modulating neurotransmitter systems, such as dopamine or serotonin receptors, is of particular interest. Moreover, the benzonitrile group has been linked to the inhibition of certain kinases and enzymes, which could contribute to the compound's therapeutic potential. Further studies are required to explore the compound’s biological activity, including its binding affinity, selectivity, and mechanism of action in relevant disease models. Its pharmacokinetic properties, such as its absorption, distribution, metabolism, and excretion (ADME) characteristics, are critical for determining its suitability as a drug candidate. In addition, the (R)-enantiomer's stereochemical properties may contribute to its potency and efficacy compared to other isomers, making it a focus of ongoing research in the field of medicinal chemistry. References 2022. Berotralstat. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-02-0191 |
| Market Analysis Reports |