|
CAS#: 27029-76-1 Product: Formaldehyde, Polymer With 3-Methylphenol And 4-Methylphenol No suppilers available for the product. |
| Name | Formaldehyde, Polymer With 3-Methylphenol And 4-Methylphenol |
|---|---|
| Synonyms | Formaldehyde; 3-Methylphenol; P-Cresol; Methanal; 3-Methylphenol; 4-Methylphenol |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 |
| CAS Registry Number | 27029-76-1 |
| SMILES | C1=CC(=CC=C1O)C.C2=C(C=CC=C2O)C.O=C |
| InChI | 1S/2C7H8O.CH2O/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;1-2/h2*2-5,8H,1H3;1H2 |
| InChIKey | AGPSIKNMWWHNRF-UHFFFAOYSA-N |
| Boiling point | 202°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 81°C (Cal.) |
| Market Analysis Reports |