|
CAS#: 9039-25-2 Product: Formaldehyde polymer with methylphenol and phenol No suppilers available for the product. |
| Name | Formaldehyde polymer with methylphenol and phenol |
|---|---|
| Synonyms | Methanal; 2-Methylphenol; Phenol; Cresylic Acid, Phenol, Formaldehyde Polymer; Formaldehyde, Methylphenol, Phenol Polymer |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 9039-25-2 |
| SMILES | C1=CC=CC=C1O.C2=C(C(=CC=C2)O)C.O=C |
| InChI | 1S/C7H8O.C6H6O.CH2O/c1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;1-2/h2-5,8H,1H3;1-5,7H;1H2 |
| InChIKey | BFPVTGJFAHMVMO-UHFFFAOYSA-N |
| Boiling point | 191°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 81.1°C (Cal.) |
| Market Analysis Reports |