|
CAS#: 2952-05-8 Product: 1,2-Diphenylaziridine No suppilers available for the product. |
| Name | 1,2-Diphenylaziridine |
|---|---|
| Synonyms | 1,2-Di(Phenyl)Ethylenimine; 1,2-Diphenylaziridine; Aziridine, 1,2-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 |
| CAS Registry Number | 2952-05-8 |
| SMILES | C1=CC=CC=C1C2N(C2)C3=CC=CC=C3 |
| InChI | 1S/C14H13N/c1-3-7-12(8-4-1)14-11-15(14)13-9-5-2-6-10-13/h1-10,14H,11H2 |
| InChIKey | MZGVUSNPNFZFGM-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.97°C at 760 mmHg (Cal.) |
| Flash point | 137.685°C (Cal.) |
| (1) | Carsten Gaebert, Christian Siegner, Jochen Mattay, Marion Toubartz and Steen Steenken. Formation of radical cations of aziridines generated by laser flash photolysis, Photochem. Photobiol. Sci., 2004, 3, 990. |
|---|---|
| Market Analysis Reports |