| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Diphenylarsenic Acid |
|---|---|
| Synonyms | Nsc 41374; 4-16-00-01178 (Beilstein Handbook Reference); Arsine Oxide, Hydroxydiphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11AsO2 |
| Molecular Weight | 262.14 |
| CAS Registry Number | 4656-80-8 |
| SMILES | C2=C([As](C1=CC=CC=C1)(O)=O)C=CC=C2 |
| InChI | 1S/C12H11AsO2/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,14,15) |
| InChIKey | SKYRWWOGLYJNCD-UHFFFAOYSA-N |
| Boiling point | 437.924°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.019°C (Cal.) |
| (1) | Kroening Karolin K.. Cytotoxicity of arsenic-containing chemical warfare agent degradation products with metallomic approaches for metabolite analysis, Metallomics, 2009 |
|---|---|
| Market Analysis Reports |