| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1-[(E)-2-Phenylethenyl]Piperidine |
|---|---|
| Synonyms | 1-[(E)-2-Phenylvinyl]Piperidine; Fmp-228; N-(2-Phenylvinyl)Piperidine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28 |
| CAS Registry Number | 332-15-0 |
| SMILES | C2=C(/C=C/N1CCCCC1)C=CC=C2 |
| InChI | 1S/C13H17N/c1-3-7-13(8-4-1)9-12-14-10-5-2-6-11-14/h1,3-4,7-9,12H,2,5-6,10-11H2/b12-9+ |
| InChIKey | PAFMWEOWHZKACA-FMIVXFBMSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.569°C at 760 mmHg (Cal.) |
| Flash point | 126.359°C (Cal.) |
| (1) | M. Victoria Jiménez, Jesús J. Pérez-Torrente, M. Isabel Bartolomé, Fernando J. Lahoz and Luis A. Oro. Rational design of efficient rhodium catalysts for the anti-markovnikov oxidative amination of styrene, Chem. Commun., 2010, 46, 5322. |
|---|---|
| Market Analysis Reports |