| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Sequoia Research Products Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 3-[(E)-2-Phenylethenyl]Phenol |
|---|---|
| Synonyms | 3-[(E)-2-Phenylvinyl]Phenol; Phenol, 3-(2-Phenylethenyl)-; 3-Stilbenol, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 76425-88-2 |
| SMILES | C1=C(C=CC=C1\C=C\C2=CC=CC=C2)O |
| InChI | 1S/C14H12O/c15-14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12/h1-11,15H/b10-9+ |
| InChIKey | XBHJTSIYYWRJFQ-MDZDMXLPSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.815°C at 760 mmHg (Cal.) |
| Flash point | 171.417°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Taro Murohoshi, Kaoru Kaneda, Masashi Ikegami and Tatsuo Arai. Photoisomerization and isomer-specific addition of water in hydroxystilbenes, Photochem. Photobiol. Sci., 2003, 2, 1247. |
|---|---|
| Market Analysis Reports |