| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Classification | Chemical reagent >> Silane reagent |
|---|---|
| Name | Silicon Tetraisocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C4N4O4Si |
| Molecular Weight | 196.15 |
| CAS Registry Number | 3410-77-3 |
| EINECS | 222-297-8 |
| SMILES | O=C=N[Si](N=C=O)(N=C=O)N=C=O |
| InChI | 1S/C4N4O4Si/c9-1-5-13(6-2-10,7-3-11)8-4-12 |
| InChIKey | UVVUGWBBCDFNSD-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Melting point | 25-28°C (Expl.) |
| Boiling point | 221.523°C at 760 mmHg (Cal.) |
| Flash point | 87.775°C (Cal.) |
| Refractive index | 1.461 (Expl.) |
| SDS | Available |
|---|---|
| (1) | Peter Portius and Martin Davis. A new hexakis(isocyanato)silicate(IV) and the first neutral Lewis-base adducts of silicon tetraisocyanate, Dalton Trans., 2010, 39, 527. |
|---|---|
| Market Analysis Reports |