| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (2,4-Dimethoxyphenyl)(Phenyl)Methanone |
|---|---|
| Synonyms | (2,4-dimethoxyphenyl)(phenyl)methanone; (2,4-dimethoxyphenyl)phenylmethanone; 2,4-dimethoxybenzophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 3555-84-8 |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)OC |
| InChI | 1S/C15H14O3/c1-17-12-8-9-13(14(10-12)18-2)15(16)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | WWVXYKPKRAMYDP-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.9±35.0°C at 760 mmHg (Cal.) |
| Flash point | 193.4±12.4°C (Cal.) |
| (1) | Yolanda Vida and Ezequiel Perez-Inestrosa. Cyclophane size drives the photochemical behaviour of benzophenone, Photochem. Photobiol. Sci., 2012, 11, 1645. |
|---|---|
| Market Analysis Reports |