|
CAS#: 70216-32-9 Product: 5-(3,4-Dimethoxyphenyl)-2-Phenyl-1,3-Oxazole No suppilers available for the product. |
| Name | 5-(3,4-Dimethoxyphenyl)-2-Phenyl-1,3-Oxazole |
|---|---|
| Synonyms | 5-(3,4-Dimethoxyphenyl)-2-Phenyl-Oxazole; 5-(3,4-Dimethoxyphenyl)-2-Phenyloxazole; Balsoxine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 |
| CAS Registry Number | 70216-32-9 |
| SMILES | C1=C(OC(=N1)C2=CC=CC=C2)C3=CC=C(OC)C(=C3)OC |
| InChI | 1S/C17H15NO3/c1-19-14-9-8-13(10-15(14)20-2)16-11-18-17(21-16)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | VABIMQUXFWWAPI-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.468°C at 760 mmHg (Cal.) |
| Flash point | 215.349°C (Cal.) |
| (1) | Ohnmacht Stephan A.. Direct arylations on water: synthesis of 2,5-disubstituted oxazoles balsoxin and texaline, Chemical Communications, 2008 |
|---|---|
| Market Analysis Reports |