| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-5-Nitro-2H-1,2,3-Triazol-4-Amine |
|---|---|
| Synonyms | 2H-1,2,3-Triazol-4-amine, 2-methyl-5-nitro-; 2-Methyl-5-nitro-2H-1,2,3-triazol-4-ylamine #; 4-Amino-2-methyl-5-nitro-1,2,3-2H-triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C3H5N5O2 |
| Molecular Weight | 143.10 |
| CAS Registry Number | 384809-41-0 |
| SMILES | CN1N=C(C(=N1)[N+](=O)[O-])N |
| InChI | 1S/C3H5N5O2/c1-7-5-2(4)3(6-7)8(9)10/h1H3,(H2,4,5) |
| InChIKey | HLBLFYHNNKOMEF-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 188.3±28.7°C (Cal.) |
| Refractive index | 1.792 (Cal.) |
| (1) | Yanqiang Zhang, Damon A. Parrish and Jean'ne M. Shreeve. Derivatives of 5-nitro-1,2,3-2H-triazole – high performance energetic materials, J. Mater. Chem. A, 2013, 1, 585. |
|---|---|
| Market Analysis Reports |