| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-5-Nitro-3-Thiophenecarboxylic Acid |
|---|---|
| Synonyms | 2-methyl-5-nitrothiophene-3-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5NO4S |
| Molecular Weight | 187.17 |
| CAS Registry Number | 566947-04-4 |
| SMILES | CC1=C(C=C(S1)[N+](=O)[O-])C(=O)O |
| InChI | 1S/C6H5NO4S/c1-3-4(6(8)9)2-5(12-3)7(10)11/h2H,1H3,(H,8,9) |
| InChIKey | VAUOSOVGVCCSSF-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 177.0±27.9°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| (1) | Abedawn I. Khalaf, Abdolrasoul H. Ebrahimabadi, Allan J. Drummond, Nahoum G. Anthony, Simon P. Mackay, Colin J. Suckling and Roger D. Waigh. Synthesis and antimicrobial activity of some netropsin analogues, Org. Biomol. Chem., 2004, 2, 3119. |
|---|---|
| Market Analysis Reports |