|
CAS#: 39342-30-8 Product: Formaldehyde, polymer with (chloromethyl)oxirane and phenol No suppilers available for the product. |
| Name | Formaldehyde, polymer with (chloromethyl)oxirane and phenol |
|---|---|
| Synonyms | 2-(Chloromethyl)Oxirane; Methanal; Phenol; Epikote 155; Formaldehyde, Polymer With (Chloromethyl)Oxirane And Phenol |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 |
| CAS Registry Number | 39342-30-8 |
| SMILES | C1=CC=CC=C1O.C(C2OC2)Cl.O=C |
| InChI | 1S/C6H6O.C3H5ClO.CH2O/c7-6-4-2-1-3-5-6;4-1-3-2-5-3;1-2/h1-5,7H;3H,1-2H2;1H2 |
| InChIKey | IRJIVOLJTYKLEH-UHFFFAOYSA-N |
| Boiling point | 181.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 72.5°C (Cal.) |
| Market Analysis Reports |