| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Formaldehyde Polymer With (Chloromethyl)Oxirane And Phenol |
|---|---|
| Synonyms | 2-(Chloromethyl)Oxirane; Methanal; Phenol; Epikote 155; Formaldehyde, Polymer With (Chloromethyl)Oxirane And Phenol |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 |
| CAS Registry Number | 9003-36-5 |
| SMILES | C1=CC=CC=C1O.C(C2OC2)Cl.O=C |
| InChI | 1S/C6H6O.C3H5ClO.CH2O/c7-6-4-2-1-3-5-6;4-1-3-2-5-3;1-2/h1-5,7H;3H,1-2H2;1H2 |
| InChIKey | IRJIVOLJTYKLEH-UHFFFAOYSA-N |
| Boiling point | 181.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 72.5°C (Cal.) |
| Market Analysis Reports |