| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Discovery Fine Chemicals Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1202) 874-517 | |||
![]() |
pjc@discofinechem.com | |||
| Chemical manufacturer | ||||
| Georganics Ltd. | Slovakia | |||
|---|---|---|---|---|
![]() |
+421 (33) 640-3132 | |||
![]() |
georganics@nextra.sk | |||
| Chemical manufacturer since 1998 | ||||
| Intatrade Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 3493 605465 | |||
![]() |
sales@intatrade.de | |||
| Chemical distributor | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | N,N'-Bis(3-Aminopropyl)-1,3-Propanediamine |
| Synonyms | 3-Azaniumylpropyl-[3-(3-Azaniumylpropylammonio)Propyl]Ammonium; 3-Ammoniopropyl-[3-(3-Ammoniopropylammonio)Propyl]Ammonium; Zinc01656877 |
| Molecular Formula | C9H28N4 |
| Molecular Weight | 192.35 |
| CAS Registry Number | 4605-14-5 |
| EINECS | 225-007-8 |
| SMILES | C(C[NH2+]CCC[NH3+])C[NH2+]CCC[NH3+] |
| InChI | 1S/C9H24N4/c10-4-1-6-12-8-3-9-13-7-2-5-11/h12-13H,1-11H2/p+4 |
| InChIKey | ZAXCZCOUDLENMH-UHFFFAOYSA-R |
| Boiling point | 282.193°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.202°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |