| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alsachim SAS | France | |||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ketobemidone |
|---|---|
| Synonyms | 1-[4-(3-Hydroxyphenyl)-1-Methyl-4-Piperidyl]Propan-1-One; 1-[4-(3-Hydroxyphenyl)-1-Methyl-4-Piperidinyl]Propan-1-One; 1-[4-(3-Hydroxyphenyl)-1-Methyl-Piperidin-4-Yl]Propan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 |
| CAS Registry Number | 469-79-4 |
| EINECS | 207-421-0 |
| SMILES | C1=C(C=CC=C1C2(CCN(C)CC2)C(CC)=O)O |
| InChI | 1S/C15H21NO2/c1-3-14(18)15(7-9-16(2)10-8-15)12-5-4-6-13(17)11-12/h4-6,11,17H,3,7-10H2,1-2H3 |
| InChIKey | ALFGKMXHOUSVAD-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 190.4±27.9°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 9628 Details |
|---|---|
| CSA Schedule: I | |
| Is Narcotics? Yes | |
| (1) | Ingela Sundström, Joris Arts, Douglas Westerlund and Per E. Andrén. In vivo investigation of brain and systemic ketobemidone metabolism, Analyst, 2010, 135, 405. |
|---|---|
| Market Analysis Reports |