| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Endotherm GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (681) 3946-7570 | |||
![]() |
info@endotherm.de | |||
| Chemical manufacturer | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 6-Benzoyl-2-Naphthol |
|---|---|
| Synonyms | (6-Hydroxy-2-Naphthyl)-Phenyl-Methanone; (6-Hydroxy-2-Naphthyl)-Phenylmethanone; (6-Hydroxynaphthalen-2-Yl)-Phenyl-Methanone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 52222-87-4 |
| EINECS | 257-755-6 |
| SMILES | C1=C3C(=CC=C1C(C2=CC=CC=C2)=O)C=C(O)C=C3 |
| InChI | 1S/C17H12O2/c18-16-9-8-13-10-15(7-6-14(13)11-16)17(19)12-4-2-1-3-5-12/h1-11,18H |
| InChIKey | MJKZGSBXCWNUHV-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.801°C at 760 mmHg (Cal.) |
| Flash point | 193.264°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Zhao et al.. Chemical genetic interrogation of natural variation uncovers a molecule that is glyco-activated, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |