|
CAS#: 7508-82-9 Product: DL-N-Benzoyl-2-Methylserine No suppilers available for the product. |
| Classification | Biochemical >> Amino acids and their derivatives >> Serine derivative |
|---|---|
| Name | DL-N-Benzoyl-2-Methylserine |
| Synonyms | (2R)-2-(Benzoylamino)-3-Hydroxy-2-Methyl-Propanoate; (2R)-3-Hydroxy-2-Methyl-2-[(Oxo-Phenylmethyl)Amino]Propanoate; (2R)-2-(Benzoylamino)-3-Hydroxy-2-Methyl-Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12NO4 |
| Molecular Weight | 222.22 |
| CAS Registry Number | 7508-82-9 |
| SMILES | [C@@](NC(=O)C1=CC=CC=C1)(CO)(C)C([O-])=O |
| InChI | 1S/C11H13NO4/c1-11(7-13,10(15)16)12-9(14)8-5-3-2-4-6-8/h2-6,13H,7H2,1H3,(H,12,14)(H,15,16)/p-1/t11-/m1/s1 |
| InChIKey | FVWQRKJTTRAXJP-LLVKDONJSA-M |
| Boiling point | 515.698°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 265.685°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |