| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | [2-(4-Nitrobenzylidene)Hydrazono](Amino)Methanethiol |
|---|---|
| Synonyms | [(4-Nitrophenyl)Methyleneamino]Thiourea; [(4-Nitrobenzylidene)Amino]Thiourea; 4-Nitrobenzaldehyde Thiosemicarbazone |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.24 |
| CAS Registry Number | 5470-48-4 |
| SMILES | C1=C(C=CC(=C1)[N+](=O)[O-])\C=N\NC(N)=S |
| InChI | 1S/C8H8N4O2S/c9-8(15)11-10-5-6-1-3-7(4-2-6)12(13)14/h1-5H,(H3,9,11,15)/b10-5+ |
| InChIKey | HSDCBIHJEGDMDO-BJMVGYQFSA-N |
| Density | 1.464g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.61°C at 760 mmHg (Cal.) |
| Flash point | 199.106°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |