| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | p-Nitrobenzylidene Tert-Butylamine |
| Synonyms | Tert-Butyl-(4-Nitrobenzylidene)Amine; Cbdive_002514; P-Nitrobenzylidene-Tert-Butylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 718-36-5 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)C=NC(C)(C)C |
| InChI | 1S/C11H14N2O2/c1-11(2,3)12-8-9-4-6-10(7-5-9)13(14)15/h4-8H,1-3H3 |
| InChIKey | BZCRPTQYJYKZDH-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.329°C at 760 mmHg (Cal.) |
| Flash point | 142.692°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |