| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 4-(Bromomethyl)Azobenzene |
|---|---|
| Synonyms | [4-(Bromomethyl)Phenyl]-Phenyl-Diazene; 4-(Bromomethyl)Azobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11BrN2 |
| Molecular Weight | 275.15 |
| CAS Registry Number | 57340-21-3 |
| EINECS | 260-684-3 |
| SMILES | C2=C(N=NC1=CC=C(C=C1)CBr)C=CC=C2 |
| InChI | 1S/C13H11BrN2/c14-10-11-6-8-13(9-7-11)16-15-12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | DFGWIAOSYURBRH-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.521°C at 760 mmHg (Cal.) |
| Flash point | 182.723°C (Cal.) |
| (1) | Fritz Vögtle, Marius Gorka, Richard Hesse, Paola Ceroni, Mauro Maestri and Vincenzo Balzani. Photochemical and photophysical properties of poly(propylene amine) dendrimers with peripheral naphthalene and azobenzene groups, Photochem. Photobiol. Sci., 2002, 1, 45. |
|---|---|
| Market Analysis Reports |