| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | D-Galactonic Acid |
|---|---|
| Synonyms | Galactonic Acid; Chebi:16534 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O7 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 576-36-3 |
| SMILES | [C@H](O)([C@@H](O)[C@H](O)CO)[C@@H](O)C(=O)O |
| InChI | 1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4+,5-/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-MGCNEYSASA-N |
| Density | 1.763g/cm3 (Cal.) |
|---|---|
| Boiling point | 673.593°C at 760 mmHg (Cal.) |
| Flash point | 375.155°C (Cal.) |
| (1) | M. Luísa Ramos, Licínia L. G. Justino and Hugh D. Burrows. Structural considerations and reactivity of peroxocomplexes of V(v), Mo(vi) and W(vi), Dalton Trans., 2011, 40, 4374. |
|---|---|
| Market Analysis Reports |