| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Stilbene |
|---|---|
| Synonyms | [(E)-2-Phenylethenyl]Benzene; 2-Phenylvinylbenzene; [(E)-2-Phenylvinyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 588-59-0 |
| EINECS | 209-621-3 |
| SMILES | C2=C(\C=C\C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11+ |
| InChIKey | PJANXHGTPQOBST-VAWYXSNFSA-N |
| Density | 1.04 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Melting point | 123°C (Expl.) |
| Boiling point | 307.024°C at 760 mmHg (Cal.) |
| 305-307°C (Expl.) | |
| Flash point | 110°C (Expl.) |
| 128.5±9.7°C (Cal.) | |
| Safety Description | Safety glasses, adequate ventilation. |
|---|---|
| CAUTION: May be harmful if swallowed | |
| WARNING: Irritates skin and eyes, harmful if swallowed | |
| (1) | Chin Hui Kee, Azhar Ariffin, Khalijah Awang, Koichi Takeya, Hiroshi Morita, Salmaan Inayat Hussain, Kok Meng Chan, Pauline J. Wood, Michael D. Threadgill, Chuan Gee Lim, SeikWeng Ng, Jean Frédéric F. Weber and Noel F. Thomas. Challenges associated with the synthesis of unusual o-carboxamido stilbenes by the Heck protocol: Intriguing substituent effects, their toxicological and chemopreventive implications, Org. Biomol. Chem., 2010, 8, 5646. |
|---|---|
| Market Analysis Reports |