| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sarchem Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 708-1777 | |||
![]() |
sarchem@aol.com | |||
| Chemical manufacturer since 1984 | ||||
| Name | Stigmatellin |
|---|---|
| Synonyms | 2-[(3S,4S,5S,6S,7E,9E,11E)-4,6-Dimethoxy-3,5,11-Trimethyl-Trideca-7,9,11-Trienyl]-8-Hydroxy-5,7-Dimethoxy-3-Methyl-Chromen-4-One; 2-[(3S,4S,5S,6S,7E,9E,11E)-4,6-Dimethoxy-3,5,11-Trimethyltrideca-7,9,11-Trienyl]-8-Hydroxy-5,7-Dimethoxy-3-Methyl-4-Chromenone |
| Molecular Structure | ![]() |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 |
| CAS Registry Number | 91682-96-1 |
| SMILES | [C@H](CCC1=C(C(=O)C2=C(O1)C(=C(OC)C=C2OC)O)C)([C@H](OC)[C@@H]([C@@H](OC)\C=C\C=C\C(=C\C)C)C)C |
| InChI | 1S/C30H42O7/c1-10-18(2)13-11-12-14-22(33-6)21(5)29(36-9)19(3)15-16-23-20(4)27(31)26-24(34-7)17-25(35-8)28(32)30(26)37-23/h10-14,17,19,21-22,29,32H,15-16H2,1-9H3/b13-11+,14-12+,18-10+/t19-,21+,22-,29-/m0/s1 |
| InChIKey | UZHDGDDPOPDJGM-CVOZLMQJSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.037°C at 760 mmHg (Cal.) |
| Flash point | 198.105°C (Cal.) |
| (1) | Ulanovskaya et al.. Synthesis Enables Identification of the Cellular Target of Leucascandrolide A and Neopeltolide, Nature Chemical Biology, 2008 |
|---|---|
| Market Analysis Reports |