| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Aromatic cinnamic acid, esters and derivatives |
|---|---|
| Name | 3-(4-Cyclohexylbenzoyl)Acrylic Acid |
| Synonyms | 3-(4-CYCLOHEXYLBENZOYL)ACRYLIC ACID |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31 |
| CAS Registry Number | 58897-74-8 |
| SMILES | O=C(c1ccc(cc1)C1CCCCC1)/C=C/C(=O)O |
| InChI | 1S/C16H18O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-12H,1-5H2,(H,18,19)/b11-10+ |
| SDS | Available |
|---|---|
| Market Analysis Reports |