| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Cyclohexyl-Benzyl Alcohol |
|---|---|
| Synonyms | Cyclohexyl-Phenyl-Methanol; 3-06-00-02527 (Beilstein Handbook Reference); Brn 2048295 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 95719-26-9 |
| SMILES | C2=C(C(C1CCCCC1)O)C=CC=C2 |
| InChI | 1S/C13H18O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-14H,2,5-6,9-10H2 |
| InChIKey | QDYKZBKCLHBUHU-UHFFFAOYSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.065°C at 760 mmHg (Cal.) |
| Flash point | 128.103°C (Cal.) |
| (1) | José A. Fuentes, Marcia B. France, Alexandra M. Z. Slawin and Matthew L. Clarke. Iridium complexes of chiral diamines containing carbon and nitrogen stereocentres: synthesis, structure and evaluation as transfer hydrogenationcatalysts, New J. Chem., 2009, 33, 466. |
|---|---|
| Market Analysis Reports |