| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Atlantic Research Chemicals Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (8707) 746-454 | |||
![]() |
info@atlantic-chemicals.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | D-Piperitone |
|---|---|
| Synonyms | (6S)-6-Isopropyl-3-Methyl-Cyclohex-2-En-1-One; (6S)-6-Isopropyl-3-Methyl-1-Cyclohex-2-Enone; (6S)-3-Methyl-6-Propan-2-Yl-Cyclohex-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 |
| CAS Registry Number | 6091-50-5 |
| SMILES | [C@@H]1(C(C=C(CC1)C)=O)C(C)C |
| InChI | 1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9H,4-5H2,1-3H3/t9-/m0/s1 |
| InChIKey | YSTPAHQEHQSRJD-VIFPVBQESA-N |
| Density | 0.915g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.999°C at 760 mmHg (Cal.) |
| Flash point | 90.885°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Christopher J. Hayes, Nicola M. A. Herbert, Nicole M. Harrington-Frost and Gerald Pattenden. a,ß-Unsaturated and cyclopropyl acyl radicals, and their ketene alkyl radical equivalents. Ring synthesis and tandem cyclisation reactions, Org. Biomol. Chem., 2005, 3, 316. |
|---|---|
| Market Analysis Reports |